C22H24N4O2 — CID 170059771
3-cyclobutyl-2-[[(3S)-1,3-dihydroxy-3-phenylbutyl]amino]benzimidazole-5-carbonitrile (PubChem CID 170059771) has the molecular formula C22H24N4O2 and a molecular weight of 376.46 g/mol. Its IUPAC name is 3-cyclobutyl-2-[[(3S)-1,3-dihydroxy-3-phenylbutyl]amino]benzimidazole-5-carbonitrile.
| Compound Name | 3-cyclobutyl-2-[[(3S)-1,3-dihydroxy-3-phenylbutyl]amino]benzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 170059771 |
| Molecular Formula | C22H24N4O2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 3-cyclobutyl-2-[[(3S)-1,3-dihydroxy-3-phenylbutyl]amino]benzimidazole-5-carbonitrile |
| SMILES | C[C@](O)(CC(O)Nc1nc2ccc(C#N)cc2n1C1CCC1)c1ccccc1 |
| InChI | InChI=1S/C22H24N4O2/c1-22(28,16-6-3-2-4-7-16)13-20(27)25-21-24-18-11-10-15(14-23)12-19(18)26(21)17-8-5-9-17/h2-4,6-7,10-12,17,20,27-28H,5,8-9,13H2,1H3,(H,24,25)/t20?,22-/m0/s1 |
| InChIKey | JKXNZIVTJPXGNO-IAXKEJLGSA-N |
| XLogP | 3.66 |
| TPSA | 94.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|