C11H20N6 — CID 170060907
(Z)-N'-propan-2-yl-2-[1-(1,2,4-triazol-1-yl)propylideneamino]prop-1-ene-1,3-diamine (PubChem CID 170060907) has the molecular formula C11H20N6 and a molecular weight of 236.32 g/mol. Its IUPAC name is (Z)-N'-propan-2-yl-2-[1-(1,2,4-triazol-1-yl)propylideneamino]prop-1-ene-1,3-diamine.
| Compound Name | (Z)-N'-propan-2-yl-2-[1-(1,2,4-triazol-1-yl)propylideneamino]prop-1-ene-1,3-diamine |
|---|---|
| PubChem CID | 170060907 |
| Molecular Formula | C11H20N6 |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.17 |
| IUPAC Name | (Z)-N'-propan-2-yl-2-[1-(1,2,4-triazol-1-yl)propylideneamino]prop-1-ene-1,3-diamine |
| SMILES | CC/C(=N\C(=C/N)CNC(C)C)n1cncn1 |
| InChI | InChI=1S/C11H20N6/c1-4-11(17-8-13-7-15-17)16-10(5-12)6-14-9(2)3/h5,7-9,14H,4,6,12H2,1-3H3/b10-5-,16-11+ |
| InChIKey | QHFHZAOURPDQTM-GAARHNRQSA-N |
| XLogP | 0.73 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|