About 1-[(1E)-3,7-dimethylocta-1,6-dienyl]-4-ethenoxybenzene
1-[(1E)-3,7-dimethylocta-1,6-dienyl]-4-ethenoxybenzene (PubChem CID 170060920) has the molecular formula C18H24O
and a molecular weight of 256.39 g/mol. Its IUPAC name is 1-[(1E)-3,7-dimethylocta-1,6-dienyl]-4-ethenoxybenzene.
Molecular Properties
| Compound Name | 1-[(1E)-3,7-dimethylocta-1,6-dienyl]-4-ethenoxybenzene |
| PubChem CID | 170060920 |
| Molecular Formula | C18H24O |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | 1-[(1E)-3,7-dimethylocta-1,6-dienyl]-4-ethenoxybenzene |
| SMILES | C=COc1ccc(/C=C/C(C)CCC=C(C)C)cc1 |
| InChI | InChI=1S/C18H24O/c1-5-19-18-13-11-17(12-14-18)10-9-16(4)8-6-7-15(2)3/h5,7,9-14,16H,1,6,8H2,2-4H3/b10-9+ |
| InChIKey | RSHOXOQSNPNAJT-MDZDMXLPSA-N |
| XLogP | 5.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1E)-3,7-dimethylocta-1,6-dienyl]-4-ethenoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1E)-3,7-dimethylocta-1,6-dienyl]-4-ethenoxybenzene?
The IUPAC name of 1-[(1E)-3,7-dimethylocta-1,6-dienyl]-4-ethenoxybenzene (CID 170060920) is 1-[(1E)-3,7-dimethylocta-1,6-dienyl]-4-ethenoxybenzene.
What is the SMILES notation for 1-[(1E)-3,7-dimethylocta-1,6-dienyl]-4-ethenoxybenzene?
The canonical SMILES for 1-[(1E)-3,7-dimethylocta-1,6-dienyl]-4-ethenoxybenzene is C=COc1ccc(/C=C/C(C)CCC=C(C)C)cc1.
What is the InChIKey of 1-[(1E)-3,7-dimethylocta-1,6-dienyl]-4-ethenoxybenzene?
The InChIKey is RSHOXOQSNPNAJT-MDZDMXLPSA-N. The full InChI is InChI=1S/C18H24O/c1-5-19-18-13-11-17(12-14-18)10-9-16(4)8-6-7-15(2)3/h5,7,9-14,16H,1,6,8H2,2-4H3/b10-9+.
What are the key properties of 1-[(1E)-3,7-dimethylocta-1,6-dienyl]-4-ethenoxybenzene?
1-[(1E)-3,7-dimethylocta-1,6-dienyl]-4-ethenoxybenzene has a molecular weight of 256.39 g/mol, XLogP of 5.60, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1E)-3,7-dimethylocta-1,6-dienyl]-4-ethenoxybenzene is sourced from PubChem (CID 170060920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).