C19H17N3O2S — CID 170061005
(E)-3-[2-(1H-indol-3-yl)-2-oxoethyl]sulfanyl-2-methyl-N-pyridin-3-ylprop-2-enamide (PubChem CID 170061005) has the molecular formula C19H17N3O2S and a molecular weight of 351.43 g/mol. Its IUPAC name is (E)-3-[2-(1H-indol-3-yl)-2-oxoethyl]sulfanyl-2-methyl-N-pyridin-3-ylprop-2-enamide.
| Compound Name | (E)-3-[2-(1H-indol-3-yl)-2-oxoethyl]sulfanyl-2-methyl-N-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 170061005 |
| Molecular Formula | C19H17N3O2S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | (E)-3-[2-(1H-indol-3-yl)-2-oxoethyl]sulfanyl-2-methyl-N-pyridin-3-ylprop-2-enamide |
| SMILES | C/C(=C\SCC(=O)c1c[nH]c2ccccc12)C(=O)Nc1cccnc1 |
| InChI | InChI=1S/C19H17N3O2S/c1-13(19(24)22-14-5-4-8-20-9-14)11-25-12-18(23)16-10-21-17-7-3-2-6-15(16)17/h2-11,21H,12H2,1H3,(H,22,24)/b13-11+ |
| InChIKey | ZUDMQBUMAINNBT-ACCUITESSA-N |
| XLogP | 4.02 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|