About 1-(7,7-dimethyloctan-4-yl)-3-(2-fluoroethoxy)azetidine
1-(7,7-dimethyloctan-4-yl)-3-(2-fluoroethoxy)azetidine (PubChem CID 170061753) has the molecular formula C15H30FNO
and a molecular weight of 259.41 g/mol. Its IUPAC name is 1-(7,7-dimethyloctan-4-yl)-3-(2-fluoroethoxy)azetidine.
Molecular Properties
| Compound Name | 1-(7,7-dimethyloctan-4-yl)-3-(2-fluoroethoxy)azetidine |
| PubChem CID | 170061753 |
| Molecular Formula | C15H30FNO |
| Molecular Weight | 259.41 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | 1-(7,7-dimethyloctan-4-yl)-3-(2-fluoroethoxy)azetidine |
| SMILES | CCCC(CCC(C)(C)C)N1CC(OCCF)C1 |
| InChI | InChI=1S/C15H30FNO/c1-5-6-13(7-8-15(2,3)4)17-11-14(12-17)18-10-9-16/h13-14H,5-12H2,1-4H3 |
| InChIKey | LMXKMATWXMFHPM-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.41 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(7,7-dimethyloctan-4-yl)-3-(2-fluoroethoxy)azetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(7,7-dimethyloctan-4-yl)-3-(2-fluoroethoxy)azetidine?
The IUPAC name of 1-(7,7-dimethyloctan-4-yl)-3-(2-fluoroethoxy)azetidine (CID 170061753) is 1-(7,7-dimethyloctan-4-yl)-3-(2-fluoroethoxy)azetidine.
What is the SMILES notation for 1-(7,7-dimethyloctan-4-yl)-3-(2-fluoroethoxy)azetidine?
The canonical SMILES for 1-(7,7-dimethyloctan-4-yl)-3-(2-fluoroethoxy)azetidine is CCCC(CCC(C)(C)C)N1CC(OCCF)C1.
What is the InChIKey of 1-(7,7-dimethyloctan-4-yl)-3-(2-fluoroethoxy)azetidine?
The InChIKey is LMXKMATWXMFHPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30FNO/c1-5-6-13(7-8-15(2,3)4)17-11-14(12-17)18-10-9-16/h13-14H,5-12H2,1-4H3.
What are the key properties of 1-(7,7-dimethyloctan-4-yl)-3-(2-fluoroethoxy)azetidine?
1-(7,7-dimethyloctan-4-yl)-3-(2-fluoroethoxy)azetidine has a molecular weight of 259.41 g/mol, XLogP of 3.65, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(7,7-dimethyloctan-4-yl)-3-(2-fluoroethoxy)azetidine is sourced from PubChem (CID 170061753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).