C18H29BrO — CID 170062648
1-(2-bromoethoxy)-4-(7-methylnonan-4-yl)benzene (PubChem CID 170062648) has the molecular formula C18H29BrO and a molecular weight of 341.33 g/mol. Its IUPAC name is 1-(2-bromoethoxy)-4-(7-methylnonan-4-yl)benzene.
| Compound Name | 1-(2-bromoethoxy)-4-(7-methylnonan-4-yl)benzene |
|---|---|
| PubChem CID | 170062648 |
| Molecular Formula | C18H29BrO |
| Molecular Weight | 341.33 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 1-(2-bromoethoxy)-4-(7-methylnonan-4-yl)benzene |
| SMILES | CCCC(CCC(C)CC)c1ccc(OCCBr)cc1 |
| InChI | InChI=1S/C18H29BrO/c1-4-6-16(8-7-15(3)5-2)17-9-11-18(12-10-17)20-14-13-19/h9-12,15-16H,4-8,13-14H2,1-3H3 |
| InChIKey | AVWFAQNATNDGCD-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.33 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|