C15H25N3O4 — CID 170062815
(2S)-2-[[1-[(2R)-aziridine-2-carbonyl]piperidine-4-carbonyl]-methylamino]-3-methylbutanoic acid (PubChem CID 170062815) has the molecular formula C15H25N3O4 and a molecular weight of 311.38 g/mol. Its IUPAC name is (2S)-2-[[1-[(2R)-aziridine-2-carbonyl]piperidine-4-carbonyl]-methylamino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[1-[(2R)-aziridine-2-carbonyl]piperidine-4-carbonyl]-methylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 170062815 |
| Molecular Formula | C15H25N3O4 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | (2S)-2-[[1-[(2R)-aziridine-2-carbonyl]piperidine-4-carbonyl]-methylamino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@@H](C(=O)O)N(C)C(=O)C1CCN(C(=O)[C@H]2CN2)CC1 |
| InChI | InChI=1S/C15H25N3O4/c1-9(2)12(15(21)22)17(3)13(19)10-4-6-18(7-5-10)14(20)11-8-16-11/h9-12,16H,4-8H2,1-3H3,(H,21,22)/t11-,12+/m1/s1 |
| InChIKey | YBKCXIOYKFFZOT-NEPJUHHUSA-N |
| XLogP | -0.24 |
| TPSA | 99.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|