C18H28N2 — CID 170063499
4-tert-butyl-1-(4-ethylphenyl)-2-methylidene-1,4-diazepane (PubChem CID 170063499) has the molecular formula C18H28N2 and a molecular weight of 272.44 g/mol. Its IUPAC name is 4-tert-butyl-1-(4-ethylphenyl)-2-methylidene-1,4-diazepane.
| Compound Name | 4-tert-butyl-1-(4-ethylphenyl)-2-methylidene-1,4-diazepane |
|---|---|
| PubChem CID | 170063499 |
| Molecular Formula | C18H28N2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | 4-tert-butyl-1-(4-ethylphenyl)-2-methylidene-1,4-diazepane |
| SMILES | C=C1CN(C(C)(C)C)CCCN1c1ccc(CC)cc1 |
| InChI | InChI=1S/C18H28N2/c1-6-16-8-10-17(11-9-16)20-13-7-12-19(14-15(20)2)18(3,4)5/h8-11H,2,6-7,12-14H2,1,3-5H3 |
| InChIKey | MTNRCEHMNHCTDK-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |