C47H32N4S — CID 170063593
12-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-14,14-dimethyl-9-thia-11-azapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1,3,5,7,10,12,15,17,19-nonaene (PubChem CID 170063593) has the molecular formula C47H32N4S and a molecular weight of 684.87 g/mol. Its IUPAC name is 12-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-14,14-dimethyl-9-thia-11-azapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1,3,5,7,10,12,15,17,19-nonaene.
| Compound Name | 12-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-14,14-dimethyl-9-thia-11-azapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1,3,5,7,10,12,15,17,19-nonaene |
|---|---|
| PubChem CID | 170063593 |
| Molecular Formula | C47H32N4S |
| Molecular Weight | 684.87 g/mol |
| Exact Mass | 684.23 |
| IUPAC Name | 12-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-14,14-dimethyl-9-thia-11-azapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1,3,5,7,10,12,15,17,19-nonaene |
| SMILES | CC1(C)c2ccccc2-c2c1c(-c1ccc(-c3ccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)cc3)cc1)nc1sc3ccccc3c21 |
| InChI | InChI=1S/C47H32N4S/c1-47(2)37-19-11-9-17-35(37)39-40-36-18-10-12-20-38(36)52-46(40)48-42(41(39)47)31-25-21-29(22-26-31)30-23-27-34(28-24-30)45-50-43(32-13-5-3-6-14-32)49-44(51-45)33-15-7-4-8-16-33/h3-28H,1-2H3 |
| InChIKey | LMOKHSFOSCBCHR-UHFFFAOYSA-N |
| XLogP | 12.28 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.87 |
| LogP ≤ 5 | 12.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |