C23H27ClN4O4S — CID 170064712
5-chloro-1'-[2-[2-(2-methylsulfonylbut-3-en-2-yl)pyrimidin-5-yl]oxyethyl]spiro[1H-indole-3,4'-piperidine]-2-one (PubChem CID 170064712) has the molecular formula C23H27ClN4O4S and a molecular weight of 491.01 g/mol. Its IUPAC name is 5-chloro-1'-[2-[2-(2-methylsulfonylbut-3-en-2-yl)pyrimidin-5-yl]oxyethyl]spiro[1H-indole-3,4'-piperidine]-2-one.
| Compound Name | 5-chloro-1'-[2-[2-(2-methylsulfonylbut-3-en-2-yl)pyrimidin-5-yl]oxyethyl]spiro[1H-indole-3,4'-piperidine]-2-one |
|---|---|
| PubChem CID | 170064712 |
| Molecular Formula | C23H27ClN4O4S |
| Molecular Weight | 491.01 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | 5-chloro-1'-[2-[2-(2-methylsulfonylbut-3-en-2-yl)pyrimidin-5-yl]oxyethyl]spiro[1H-indole-3,4'-piperidine]-2-one |
| SMILES | C=CC(C)(c1ncc(OCCN2CCC3(CC2)C(=O)Nc2ccc(Cl)cc23)cn1)S(C)(=O)=O |
| InChI | InChI=1S/C23H27ClN4O4S/c1-4-22(2,33(3,30)31)20-25-14-17(15-26-20)32-12-11-28-9-7-23(8-10-28)18-13-16(24)5-6-19(18)27-21(23)29/h4-6,13-15H,1,7-12H2,2-3H3,(H,27,29) |
| InChIKey | QXOSUQSWQDXBFH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.01 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|