C11H21NO4 — CID 170064734
3-methyl-5-(piperidin-3-yloxymethyl)oxolane-2,4-diol (PubChem CID 170064734) has the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. Its IUPAC name is 3-methyl-5-(piperidin-3-yloxymethyl)oxolane-2,4-diol.
| Compound Name | 3-methyl-5-(piperidin-3-yloxymethyl)oxolane-2,4-diol |
|---|---|
| PubChem CID | 170064734 |
| Molecular Formula | C11H21NO4 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | 3-methyl-5-(piperidin-3-yloxymethyl)oxolane-2,4-diol |
| SMILES | CC1C(O)OC(COC2CCCNC2)C1O |
| InChI | InChI=1S/C11H21NO4/c1-7-10(13)9(16-11(7)14)6-15-8-3-2-4-12-5-8/h7-14H,2-6H2,1H3 |
| InChIKey | SJMRUWLRHANAOB-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |