C24H43FN2 — CID 170064782
(1E,7Z)-3-ethyl-8-N-(1-fluoroethyl)-1-N,2,7-trimethyl-1-N-(2-methylpentyl)undeca-1,7-dien-9-yne-1,8-diamine (PubChem CID 170064782) has the molecular formula C24H43FN2 and a molecular weight of 378.62 g/mol. Its IUPAC name is (1E,7Z)-3-ethyl-8-N-(1-fluoroethyl)-1-N,2,7-trimethyl-1-N-(2-methylpentyl)undeca-1,7-dien-9-yne-1,8-diamine.
| Compound Name | (1E,7Z)-3-ethyl-8-N-(1-fluoroethyl)-1-N,2,7-trimethyl-1-N-(2-methylpentyl)undeca-1,7-dien-9-yne-1,8-diamine |
|---|---|
| PubChem CID | 170064782 |
| Molecular Formula | C24H43FN2 |
| Molecular Weight | 378.62 g/mol |
| Exact Mass | 378.34 |
| IUPAC Name | (1E,7Z)-3-ethyl-8-N-(1-fluoroethyl)-1-N,2,7-trimethyl-1-N-(2-methylpentyl)undeca-1,7-dien-9-yne-1,8-diamine |
| SMILES | CC#C/C(NC(C)F)=C(\C)CCCC(CC)/C(C)=C/N(C)CC(C)CCC |
| InChI | InChI=1S/C24H43FN2/c1-9-13-19(4)17-27(8)18-21(6)23(11-3)16-12-15-20(5)24(14-10-2)26-22(7)25/h18-19,22-23,26H,9,11-13,15-17H2,1-8H3/b21-18+,24-20- |
| InChIKey | AJXYPQPAVYDNGF-OKNSNVGXSA-N |
| XLogP | 6.66 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.62 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|