C27H33ClN2O5 — CID 170064947
8-chloro-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-11-methyl-2-(4-oxocyclohexyl)-3,4,5,6-tetrahydro-2H-1,7-benzodioxonine-10-carboxamide (PubChem CID 170064947) has the molecular formula C27H33ClN2O5 and a molecular weight of 501.02 g/mol. Its IUPAC name is 8-chloro-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-11-methyl-2-(4-oxocyclohexyl)-3,4,5,6-tetrahydro-2H-1,7-benzodioxonine-10-carboxamide.
| Compound Name | 8-chloro-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-11-methyl-2-(4-oxocyclohexyl)-3,4,5,6-tetrahydro-2H-1,7-benzodioxonine-10-carboxamide |
|---|---|
| PubChem CID | 170064947 |
| Molecular Formula | C27H33ClN2O5 |
| Molecular Weight | 501.02 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | 8-chloro-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-11-methyl-2-(4-oxocyclohexyl)-3,4,5,6-tetrahydro-2H-1,7-benzodioxonine-10-carboxamide |
| SMILES | Cc1cc(C)c(CNC(=O)c2cc(Cl)c3c(c2C)OC(C2CCC(=O)CC2)CCCCO3)c(=O)[nH]1 |
| InChI | InChI=1S/C27H33ClN2O5/c1-15-12-16(2)30-27(33)21(15)14-29-26(32)20-13-22(28)25-24(17(20)3)35-23(6-4-5-11-34-25)18-7-9-19(31)10-8-18/h12-13,18,23H,4-11,14H2,1-3H3,(H,29,32)(H,30,33) |
| InChIKey | GQRDBEFTHXVMFN-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 97.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.02 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |