C16H22O3 — CID 170065941
(1S,8R,9S,13R)-4,8-dihydroxy-7,13-dimethyltricyclo[7.5.0.01,5]tetradeca-6,10-dien-14-one (PubChem CID 170065941) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is (1S,8R,9S,13R)-4,8-dihydroxy-7,13-dimethyltricyclo[7.5.0.01,5]tetradeca-6,10-dien-14-one.
| Compound Name | (1S,8R,9S,13R)-4,8-dihydroxy-7,13-dimethyltricyclo[7.5.0.01,5]tetradeca-6,10-dien-14-one |
|---|---|
| PubChem CID | 170065941 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | (1S,8R,9S,13R)-4,8-dihydroxy-7,13-dimethyltricyclo[7.5.0.01,5]tetradeca-6,10-dien-14-one |
| SMILES | CC1=CC2C(O)CC[C@]23C(=O)[C@H](C)CC=C[C@@H]3[C@H]1O |
| InChI | InChI=1S/C16H22O3/c1-9-4-3-5-11-14(18)10(2)8-12-13(17)6-7-16(11,12)15(9)19/h3,5,8-9,11-14,17-18H,4,6-7H2,1-2H3/t9-,11-,12?,13?,14+,16-/m1/s1 |
| InChIKey | VAMVNAFAUFAQFC-CHNCTZSFSA-N |
| XLogP | 1.85 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|