C34H44O3 — CID 170066009
(2E,4E)-5-tert-butyl-2-ethenyl-1-[5-[(2E,3Z,5E)-2-ethylidene-5-[(2-methylpropan-2-yl)oxy]hepta-3,5-dienoyl]-3-methylcyclohepta-1,4,6-trien-1-yl]hepta-2,4,6-trien-1-one (PubChem CID 170066009) has the molecular formula C34H44O3 and a molecular weight of 500.72 g/mol. Its IUPAC name is (2E,4E)-5-tert-butyl-2-ethenyl-1-[5-[(2E,3Z,5E)-2-ethylidene-5-[(2-methylpropan-2-yl)oxy]hepta-3,5-dienoyl]-3-methylcyclohepta-1,4,6-trien-1-yl]hepta-2,4,6-trien-1-one.
| Compound Name | (2E,4E)-5-tert-butyl-2-ethenyl-1-[5-[(2E,3Z,5E)-2-ethylidene-5-[(2-methylpropan-2-yl)oxy]hepta-3,5-dienoyl]-3-methylcyclohepta-1,4,6-trien-1-yl]hepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 170066009 |
| Molecular Formula | C34H44O3 |
| Molecular Weight | 500.72 g/mol |
| Exact Mass | 500.33 |
| IUPAC Name | (2E,4E)-5-tert-butyl-2-ethenyl-1-[5-[(2E,3Z,5E)-2-ethylidene-5-[(2-methylpropan-2-yl)oxy]hepta-3,5-dienoyl]-3-methylcyclohepta-1,4,6-trien-1-yl]hepta-2,4,6-trien-1-one |
| SMILES | C=C/C(=C\C=C(/C=C)C(C)(C)C)C(=O)C1=CC(C)C=C(C(=O)C(/C=C\C(=C/C)OC(C)(C)C)=C/C)C=C1 |
| InChI | InChI=1S/C34H44O3/c1-12-25(18-20-29(14-3)33(6,7)8)31(35)27-16-17-28(23-24(5)22-27)32(36)26(13-2)19-21-30(15-4)37-34(9,10)11/h12-24H,1,3H2,2,4-11H3/b21-19-,25-18+,26-13+,29-20+,30-15+ |
| InChIKey | JMQLHQZMWGZALL-KOPCHVFKSA-N |
| XLogP | 8.68 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.72 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|