About N'-ethenyl-2,2,2-trifluoro-N-methyl-N-propan-2-ylethanimidamide
N'-ethenyl-2,2,2-trifluoro-N-methyl-N-propan-2-ylethanimidamide (PubChem CID 170067039) has the molecular formula C8H13F3N2
and a molecular weight of 194.20 g/mol. Its IUPAC name is N'-ethenyl-2,2,2-trifluoro-N-methyl-N-propan-2-ylethanimidamide.
Molecular Properties
| Compound Name | N'-ethenyl-2,2,2-trifluoro-N-methyl-N-propan-2-ylethanimidamide |
| PubChem CID | 170067039 |
| Molecular Formula | C8H13F3N2 |
| Molecular Weight | 194.20 g/mol |
| Exact Mass | 194.10 |
| IUPAC Name | N'-ethenyl-2,2,2-trifluoro-N-methyl-N-propan-2-ylethanimidamide |
| SMILES | C=C/N=C(\N(C)C(C)C)C(F)(F)F |
| InChI | InChI=1S/C8H13F3N2/c1-5-12-7(8(9,10)11)13(4)6(2)3/h5-6H,1H2,2-4H3/b12-7- |
| InChIKey | VJMHHWZNGVWVAY-GHXNOFRVSA-N |
| XLogP | 2.43 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.20 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-ethenyl-2,2,2-trifluoro-N-methyl-N-propan-2-ylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-ethenyl-2,2,2-trifluoro-N-methyl-N-propan-2-ylethanimidamide?
The IUPAC name of N'-ethenyl-2,2,2-trifluoro-N-methyl-N-propan-2-ylethanimidamide (CID 170067039) is N'-ethenyl-2,2,2-trifluoro-N-methyl-N-propan-2-ylethanimidamide.
What is the SMILES notation for N'-ethenyl-2,2,2-trifluoro-N-methyl-N-propan-2-ylethanimidamide?
The canonical SMILES for N'-ethenyl-2,2,2-trifluoro-N-methyl-N-propan-2-ylethanimidamide is C=C/N=C(\N(C)C(C)C)C(F)(F)F.
What is the InChIKey of N'-ethenyl-2,2,2-trifluoro-N-methyl-N-propan-2-ylethanimidamide?
The InChIKey is VJMHHWZNGVWVAY-GHXNOFRVSA-N. The full InChI is InChI=1S/C8H13F3N2/c1-5-12-7(8(9,10)11)13(4)6(2)3/h5-6H,1H2,2-4H3/b12-7-.
What are the key properties of N'-ethenyl-2,2,2-trifluoro-N-methyl-N-propan-2-ylethanimidamide?
N'-ethenyl-2,2,2-trifluoro-N-methyl-N-propan-2-ylethanimidamide has a molecular weight of 194.20 g/mol, XLogP of 2.43, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-ethenyl-2,2,2-trifluoro-N-methyl-N-propan-2-ylethanimidamide is sourced from PubChem (CID 170067039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).