About 1-(3-methylsulfonylphenyl)-5,7-dihydro-4H-pyrano[4,3-d]pyrazole
1-(3-methylsulfonylphenyl)-5,7-dihydro-4H-pyrano[4,3-d]pyrazole (PubChem CID 170067065) has the molecular formula C13H14N2O3S
and a molecular weight of 278.33 g/mol. Its IUPAC name is 1-(3-methylsulfonylphenyl)-5,7-dihydro-4H-pyrano[4,3-d]pyrazole.
Molecular Properties
| Compound Name | 1-(3-methylsulfonylphenyl)-5,7-dihydro-4H-pyrano[4,3-d]pyrazole |
| PubChem CID | 170067065 |
| Molecular Formula | C13H14N2O3S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 1-(3-methylsulfonylphenyl)-5,7-dihydro-4H-pyrano[4,3-d]pyrazole |
| SMILES | CS(=O)(=O)c1cccc(-n2ncc3c2COCC3)c1 |
| InChI | InChI=1S/C13H14N2O3S/c1-19(16,17)12-4-2-3-11(7-12)15-13-9-18-6-5-10(13)8-14-15/h2-4,7-8H,5-6,9H2,1H3 |
| InChIKey | PPCMTYXRPNWISK-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(3-methylsulfonylphenyl)-5,7-dihydro-4H-pyrano[4,3-d]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-methylsulfonylphenyl)-5,7-dihydro-4H-pyrano[4,3-d]pyrazole?
The IUPAC name of 1-(3-methylsulfonylphenyl)-5,7-dihydro-4H-pyrano[4,3-d]pyrazole (CID 170067065) is 1-(3-methylsulfonylphenyl)-5,7-dihydro-4H-pyrano[4,3-d]pyrazole.
What is the SMILES notation for 1-(3-methylsulfonylphenyl)-5,7-dihydro-4H-pyrano[4,3-d]pyrazole?
The canonical SMILES for 1-(3-methylsulfonylphenyl)-5,7-dihydro-4H-pyrano[4,3-d]pyrazole is CS(=O)(=O)c1cccc(-n2ncc3c2COCC3)c1.
What is the InChIKey of 1-(3-methylsulfonylphenyl)-5,7-dihydro-4H-pyrano[4,3-d]pyrazole?
The InChIKey is PPCMTYXRPNWISK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O3S/c1-19(16,17)12-4-2-3-11(7-12)15-13-9-18-6-5-10(13)8-14-15/h2-4,7-8H,5-6,9H2,1H3.
What are the key properties of 1-(3-methylsulfonylphenyl)-5,7-dihydro-4H-pyrano[4,3-d]pyrazole?
1-(3-methylsulfonylphenyl)-5,7-dihydro-4H-pyrano[4,3-d]pyrazole has a molecular weight of 278.33 g/mol, XLogP of 1.35, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-methylsulfonylphenyl)-5,7-dihydro-4H-pyrano[4,3-d]pyrazole is sourced from PubChem (CID 170067065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).