About 1-(2-methylphenyl)-5,7-dihydro-4H-pyrano[4,3-d]pyrazole
1-(2-methylphenyl)-5,7-dihydro-4H-pyrano[4,3-d]pyrazole (PubChem CID 170067075) has the molecular formula C13H14N2O
and a molecular weight of 214.27 g/mol. Its IUPAC name is 1-(2-methylphenyl)-5,7-dihydro-4H-pyrano[4,3-d]pyrazole.
Molecular Properties
| Compound Name | 1-(2-methylphenyl)-5,7-dihydro-4H-pyrano[4,3-d]pyrazole |
| PubChem CID | 170067075 |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 1-(2-methylphenyl)-5,7-dihydro-4H-pyrano[4,3-d]pyrazole |
| SMILES | Cc1ccccc1-n1ncc2c1COCC2 |
| InChI | InChI=1S/C13H14N2O/c1-10-4-2-3-5-12(10)15-13-9-16-7-6-11(13)8-14-15/h2-5,8H,6-7,9H2,1H3 |
| InChIKey | UGNUANGJFCGLCR-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2-methylphenyl)-5,7-dihydro-4H-pyrano[4,3-d]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methylphenyl)-5,7-dihydro-4H-pyrano[4,3-d]pyrazole?
The IUPAC name of 1-(2-methylphenyl)-5,7-dihydro-4H-pyrano[4,3-d]pyrazole (CID 170067075) is 1-(2-methylphenyl)-5,7-dihydro-4H-pyrano[4,3-d]pyrazole.
What is the SMILES notation for 1-(2-methylphenyl)-5,7-dihydro-4H-pyrano[4,3-d]pyrazole?
The canonical SMILES for 1-(2-methylphenyl)-5,7-dihydro-4H-pyrano[4,3-d]pyrazole is Cc1ccccc1-n1ncc2c1COCC2.
What is the InChIKey of 1-(2-methylphenyl)-5,7-dihydro-4H-pyrano[4,3-d]pyrazole?
The InChIKey is UGNUANGJFCGLCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O/c1-10-4-2-3-5-12(10)15-13-9-16-7-6-11(13)8-14-15/h2-5,8H,6-7,9H2,1H3.
What are the key properties of 1-(2-methylphenyl)-5,7-dihydro-4H-pyrano[4,3-d]pyrazole?
1-(2-methylphenyl)-5,7-dihydro-4H-pyrano[4,3-d]pyrazole has a molecular weight of 214.27 g/mol, XLogP of 2.25, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methylphenyl)-5,7-dihydro-4H-pyrano[4,3-d]pyrazole is sourced from PubChem (CID 170067075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).