C14H18O2S — CID 170067266
(10bS)-6-methyl-4,4a,5a,6,7,10b-hexahydro-3H-cyclohepta[b][1]benzothiole 5,5-dioxide (PubChem CID 170067266) has the molecular formula C14H18O2S and a molecular weight of 250.36 g/mol. Its IUPAC name is (10bS)-6-methyl-4,4a,5a,6,7,10b-hexahydro-3H-cyclohepta[b][1]benzothiole 5,5-dioxide.
| Compound Name | (10bS)-6-methyl-4,4a,5a,6,7,10b-hexahydro-3H-cyclohepta[b][1]benzothiole 5,5-dioxide |
|---|---|
| PubChem CID | 170067266 |
| Molecular Formula | C14H18O2S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | (10bS)-6-methyl-4,4a,5a,6,7,10b-hexahydro-3H-cyclohepta[b][1]benzothiole 5,5-dioxide |
| SMILES | CC1CC=CC=C2C1S(=O)(=O)C1CCC=C[C@@H]21 |
| InChI | InChI=1S/C14H18O2S/c1-10-6-2-3-8-12-11-7-4-5-9-13(11)17(15,16)14(10)12/h2-4,7-8,10-11,13-14H,5-6,9H2,1H3/t10?,11-,13?,14?/m0/s1 |
| InChIKey | DBRMPOWYKHZMSG-OIOVUNLQSA-N |
| XLogP | 2.64 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|