C9H14F3N — CID 170067478
(2Z)-1,1,1-trifluoro-N-methyl-N-propan-2-ylpenta-2,4-dien-2-amine (PubChem CID 170067478) has the molecular formula C9H14F3N and a molecular weight of 193.21 g/mol. Its IUPAC name is (2Z)-1,1,1-trifluoro-N-methyl-N-propan-2-ylpenta-2,4-dien-2-amine.
| Compound Name | (2Z)-1,1,1-trifluoro-N-methyl-N-propan-2-ylpenta-2,4-dien-2-amine |
|---|---|
| PubChem CID | 170067478 |
| Molecular Formula | C9H14F3N |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | (2Z)-1,1,1-trifluoro-N-methyl-N-propan-2-ylpenta-2,4-dien-2-amine |
| SMILES | C=C/C=C(\N(C)C(C)C)C(F)(F)F |
| InChI | InChI=1S/C9H14F3N/c1-5-6-8(9(10,11)12)13(4)7(2)3/h5-7H,1H2,2-4H3/b8-6- |
| InChIKey | YRGPLTNXXSZZEM-VURMDHGXSA-N |
| XLogP | 2.96 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|