C23H28IN7O2 — CID 170067745
N-(4-amino-1H-pyrazolo[4,5-c]pyridin-7-yl)-2-[(2R,5S)-2-[4-[2-[iodo(methyl)amino]ethyl]phenyl]-5-methylpiperidin-1-yl]-2-oxoacetamide (PubChem CID 170067745) has the molecular formula C23H28IN7O2 and a molecular weight of 561.43 g/mol. Its IUPAC name is N-(4-amino-1H-pyrazolo[4,5-c]pyridin-7-yl)-2-[(2R,5S)-2-[4-[2-[iodo(methyl)amino]ethyl]phenyl]-5-methylpiperidin-1-yl]-2-oxoacetamide.
| Compound Name | N-(4-amino-1H-pyrazolo[4,5-c]pyridin-7-yl)-2-[(2R,5S)-2-[4-[2-[iodo(methyl)amino]ethyl]phenyl]-5-methylpiperidin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 170067745 |
| Molecular Formula | C23H28IN7O2 |
| Molecular Weight | 561.43 g/mol |
| Exact Mass | 561.13 |
| IUPAC Name | N-(4-amino-1H-pyrazolo[4,5-c]pyridin-7-yl)-2-[(2R,5S)-2-[4-[2-[iodo(methyl)amino]ethyl]phenyl]-5-methylpiperidin-1-yl]-2-oxoacetamide |
| SMILES | C[C@H]1CC[C@H](c2ccc(CCN(C)I)cc2)N(C(=O)C(=O)Nc2cnc(N)c3cn[nH]c23)C1 |
| InChI | InChI=1S/C23H28IN7O2/c1-14-3-8-19(16-6-4-15(5-7-16)9-10-30(2)24)31(13-14)23(33)22(32)28-18-12-26-21(25)17-11-27-29-20(17)18/h4-7,11-12,14,19H,3,8-10,13H2,1-2H3,(H2,25,26)(H,27,29)(H,28,32)/t14-,19+/m0/s1 |
| InChIKey | XJXYVDZVAGOOPK-IFXJQAMLSA-N |
| XLogP | 3.30 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|