C14H23N3 — CID 170067814
1,2-dimethyl-1-[(3Z,5Z)-2-methyl-3-prop-1-ynylhepta-3,5-dienyl]guanidine (PubChem CID 170067814) has the molecular formula C14H23N3 and a molecular weight of 233.36 g/mol. Its IUPAC name is 1,2-dimethyl-1-[(3Z,5Z)-2-methyl-3-prop-1-ynylhepta-3,5-dienyl]guanidine.
| Compound Name | 1,2-dimethyl-1-[(3Z,5Z)-2-methyl-3-prop-1-ynylhepta-3,5-dienyl]guanidine |
|---|---|
| PubChem CID | 170067814 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | 1,2-dimethyl-1-[(3Z,5Z)-2-methyl-3-prop-1-ynylhepta-3,5-dienyl]guanidine |
| SMILES | CC#C/C(=C\C=C/C)C(C)CN(C)/C(N)=N/C |
| InChI | InChI=1S/C14H23N3/c1-6-8-10-13(9-7-2)12(3)11-17(5)14(15)16-4/h6,8,10,12H,11H2,1-5H3,(H2,15,16)/b8-6-,13-10+ |
| InChIKey | IADLBKSKCITFLA-WLPHGBIISA-N |
| XLogP | 2.02 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|