C21H25N3O — CID 17006783
2-methyl-N-[(1-pentylbenzimidazol-2-yl)methyl]benzamide (PubChem CID 17006783) has the molecular formula C21H25N3O and a molecular weight of 335.45 g/mol. Its IUPAC name is 2-methyl-N-[(1-pentylbenzimidazol-2-yl)methyl]benzamide.
| Compound Name | 2-methyl-N-[(1-pentylbenzimidazol-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 17006783 |
| Molecular Formula | C21H25N3O |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | 2-methyl-N-[(1-pentylbenzimidazol-2-yl)methyl]benzamide |
| SMILES | CCCCCn1c(CNC(=O)c2ccccc2C)nc2ccccc21 |
| InChI | InChI=1S/C21H25N3O/c1-3-4-9-14-24-19-13-8-7-12-18(19)23-20(24)15-22-21(25)17-11-6-5-10-16(17)2/h5-8,10-13H,3-4,9,14-15H2,1-2H3,(H,22,25) |
| InChIKey | PQYVKSUBQUORSH-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|