C53H39N3O2 — CID 170068094
N'-[2-[[8-[(1E,3Z,5Z)-hepta-1,3,5-trienyl]-6-phenyldibenzofuran-1-yl]methyl]-1-benzofuran-3-yl]-9-phenylcarbazole-2-carboximidamide (PubChem CID 170068094) has the molecular formula C53H39N3O2 and a molecular weight of 749.91 g/mol. Its IUPAC name is N'-[2-[[8-[(1E,3Z,5Z)-hepta-1,3,5-trienyl]-6-phenyldibenzofuran-1-yl]methyl]-1-benzofuran-3-yl]-9-phenylcarbazole-2-carboximidamide.
| Compound Name | N'-[2-[[8-[(1E,3Z,5Z)-hepta-1,3,5-trienyl]-6-phenyldibenzofuran-1-yl]methyl]-1-benzofuran-3-yl]-9-phenylcarbazole-2-carboximidamide |
|---|---|
| PubChem CID | 170068094 |
| Molecular Formula | C53H39N3O2 |
| Molecular Weight | 749.91 g/mol |
| Exact Mass | 749.30 |
| IUPAC Name | N'-[2-[[8-[(1E,3Z,5Z)-hepta-1,3,5-trienyl]-6-phenyldibenzofuran-1-yl]methyl]-1-benzofuran-3-yl]-9-phenylcarbazole-2-carboximidamide |
| SMILES | C/C=C\C=C/C=C/c1cc(-c2ccccc2)c2oc3cccc(Cc4oc5ccccc5c4/N=C(\N)c4ccc5c6ccccc6n(-c6ccccc6)c5c4)c3c2c1 |
| InChI | InChI=1S/C53H39N3O2/c1-2-3-4-5-8-18-35-31-43(36-19-9-6-10-20-36)52-44(32-35)50-37(21-17-28-48(50)58-52)34-49-51(42-25-14-16-27-47(42)57-49)55-53(54)38-29-30-41-40-24-13-15-26-45(40)56(46(41)33-38)39-22-11-7-12-23-39/h2-33H,34H2,1H3,(H2,54,55)/b3-2-,5-4-,18-8+ |
| InChIKey | INILCJSKRTXAIA-MIBMPRHWSA-N |
| XLogP | 13.87 |
| TPSA | 69.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.91 |
| LogP ≤ 5 | 13.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|