C11H15NOS — CID 170068193
dicyclopropyl-(4-methyl-1,3-thiazol-2-yl)methanol (PubChem CID 170068193) has the molecular formula C11H15NOS and a molecular weight of 209.31 g/mol. Its IUPAC name is dicyclopropyl-(4-methyl-1,3-thiazol-2-yl)methanol.
| Compound Name | dicyclopropyl-(4-methyl-1,3-thiazol-2-yl)methanol |
|---|---|
| PubChem CID | 170068193 |
| Molecular Formula | C11H15NOS |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | dicyclopropyl-(4-methyl-1,3-thiazol-2-yl)methanol |
| SMILES | Cc1csc(C(O)(C2CC2)C2CC2)n1 |
| InChI | InChI=1S/C11H15NOS/c1-7-6-14-10(12-7)11(13,8-2-3-8)9-4-5-9/h6,8-9,13H,2-5H2,1H3 |
| InChIKey | AYEABUZXKFUSMO-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |