About 1,1-difluoroethyl-imino-[3-(piperidin-4-ylmethyl)phenyl]-λ4-sulfane
1,1-difluoroethyl-imino-[3-(piperidin-4-ylmethyl)phenyl]-λ4-sulfane (PubChem CID 170068494) has the molecular formula C14H20F2N2S
and a molecular weight of 286.39 g/mol. Its IUPAC name is 1,1-difluoroethyl-imino-[3-(piperidin-4-ylmethyl)phenyl]-λ4-sulfane.
Molecular Properties
| Compound Name | 1,1-difluoroethyl-imino-[3-(piperidin-4-ylmethyl)phenyl]-λ4-sulfane |
| PubChem CID | 170068494 |
| Molecular Formula | C14H20F2N2S |
| Molecular Weight | 286.39 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 1,1-difluoroethyl-imino-[3-(piperidin-4-ylmethyl)phenyl]-λ4-sulfane |
| SMILES | [H]/N=S(\c1cccc(CC2CCNCC2)c1)C(C)(F)F |
| InChI | InChI=1S/C14H20F2N2S/c1-14(15,16)19(17)13-4-2-3-12(10-13)9-11-5-7-18-8-6-11/h2-4,10-11,17-18H,5-9H2,1H3 |
| InChIKey | LQMIWEQNHRNKRA-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.39 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,1-difluoroethyl-imino-[3-(piperidin-4-ylmethyl)phenyl]-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-difluoroethyl-imino-[3-(piperidin-4-ylmethyl)phenyl]-λ4-sulfane?
The IUPAC name of 1,1-difluoroethyl-imino-[3-(piperidin-4-ylmethyl)phenyl]-λ4-sulfane (CID 170068494) is 1,1-difluoroethyl-imino-[3-(piperidin-4-ylmethyl)phenyl]-λ4-sulfane.
What is the SMILES notation for 1,1-difluoroethyl-imino-[3-(piperidin-4-ylmethyl)phenyl]-λ4-sulfane?
The canonical SMILES for 1,1-difluoroethyl-imino-[3-(piperidin-4-ylmethyl)phenyl]-λ4-sulfane is [H]/N=S(\c1cccc(CC2CCNCC2)c1)C(C)(F)F.
What is the InChIKey of 1,1-difluoroethyl-imino-[3-(piperidin-4-ylmethyl)phenyl]-λ4-sulfane?
The InChIKey is LQMIWEQNHRNKRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20F2N2S/c1-14(15,16)19(17)13-4-2-3-12(10-13)9-11-5-7-18-8-6-11/h2-4,10-11,17-18H,5-9H2,1H3.
What are the key properties of 1,1-difluoroethyl-imino-[3-(piperidin-4-ylmethyl)phenyl]-λ4-sulfane?
1,1-difluoroethyl-imino-[3-(piperidin-4-ylmethyl)phenyl]-λ4-sulfane has a molecular weight of 286.39 g/mol, XLogP of 3.58, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-difluoroethyl-imino-[3-(piperidin-4-ylmethyl)phenyl]-λ4-sulfane is sourced from PubChem (CID 170068494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).