About 4-[3-(5-chloro-2-methylidenespiro[1H-indole-3,4'-piperidine]-1'-yl)propyl]aniline
4-[3-(5-chloro-2-methylidenespiro[1H-indole-3,4'-piperidine]-1'-yl)propyl]aniline (PubChem CID 170068527) has the molecular formula C22H26ClN3
and a molecular weight of 367.92 g/mol. Its IUPAC name is 4-[3-(5-chloro-2-methylidenespiro[1H-indole-3,4'-piperidine]-1'-yl)propyl]aniline.
Molecular Properties
| Compound Name | 4-[3-(5-chloro-2-methylidenespiro[1H-indole-3,4'-piperidine]-1'-yl)propyl]aniline |
| PubChem CID | 170068527 |
| Molecular Formula | C22H26ClN3 |
| Molecular Weight | 367.92 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 4-[3-(5-chloro-2-methylidenespiro[1H-indole-3,4'-piperidine]-1'-yl)propyl]aniline |
| SMILES | C=C1Nc2ccc(Cl)cc2C12CCN(CCCc1ccc(N)cc1)CC2 |
| InChI | InChI=1S/C22H26ClN3/c1-16-22(20-15-18(23)6-9-21(20)25-16)10-13-26(14-11-22)12-2-3-17-4-7-19(24)8-5-17/h4-9,15,25H,1-3,10-14,24H2 |
| InChIKey | ZWKHWPOXAKCTQE-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.92 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-(5-chloro-2-methylidenespiro[1H-indole-3,4'-piperidine]-1'-yl)propyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(5-chloro-2-methylidenespiro[1H-indole-3,4'-piperidine]-1'-yl)propyl]aniline?
The IUPAC name of 4-[3-(5-chloro-2-methylidenespiro[1H-indole-3,4'-piperidine]-1'-yl)propyl]aniline (CID 170068527) is 4-[3-(5-chloro-2-methylidenespiro[1H-indole-3,4'-piperidine]-1'-yl)propyl]aniline.
What is the SMILES notation for 4-[3-(5-chloro-2-methylidenespiro[1H-indole-3,4'-piperidine]-1'-yl)propyl]aniline?
The canonical SMILES for 4-[3-(5-chloro-2-methylidenespiro[1H-indole-3,4'-piperidine]-1'-yl)propyl]aniline is C=C1Nc2ccc(Cl)cc2C12CCN(CCCc1ccc(N)cc1)CC2.
What is the InChIKey of 4-[3-(5-chloro-2-methylidenespiro[1H-indole-3,4'-piperidine]-1'-yl)propyl]aniline?
The InChIKey is ZWKHWPOXAKCTQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26ClN3/c1-16-22(20-15-18(23)6-9-21(20)25-16)10-13-26(14-11-22)12-2-3-17-4-7-19(24)8-5-17/h4-9,15,25H,1-3,10-14,24H2.
What are the key properties of 4-[3-(5-chloro-2-methylidenespiro[1H-indole-3,4'-piperidine]-1'-yl)propyl]aniline?
4-[3-(5-chloro-2-methylidenespiro[1H-indole-3,4'-piperidine]-1'-yl)propyl]aniline has a molecular weight of 367.92 g/mol, XLogP of 4.83, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(5-chloro-2-methylidenespiro[1H-indole-3,4'-piperidine]-1'-yl)propyl]aniline is sourced from PubChem (CID 170068527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).