C13H19F3N2O — CID 170068978
N-[(1E,3E)-4-methyl-5-piperidin-4-yl-1-(trifluoromethoxy)penta-1,3-dienyl]methanimine (PubChem CID 170068978) has the molecular formula C13H19F3N2O and a molecular weight of 276.30 g/mol. Its IUPAC name is N-[(1E,3E)-4-methyl-5-piperidin-4-yl-1-(trifluoromethoxy)penta-1,3-dienyl]methanimine.
| Compound Name | N-[(1E,3E)-4-methyl-5-piperidin-4-yl-1-(trifluoromethoxy)penta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 170068978 |
| Molecular Formula | C13H19F3N2O |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | N-[(1E,3E)-4-methyl-5-piperidin-4-yl-1-(trifluoromethoxy)penta-1,3-dienyl]methanimine |
| SMILES | C=N/C(=C\C=C(/C)CC1CCNCC1)OC(F)(F)F |
| InChI | InChI=1S/C13H19F3N2O/c1-10(9-11-5-7-18-8-6-11)3-4-12(17-2)19-13(14,15)16/h3-4,11,18H,2,5-9H2,1H3/b10-3+,12-4+ |
| InChIKey | KNRORQFKDXSMEU-FCNOOXGGSA-N |
| XLogP | 3.40 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|