C34H63NO — CID 170069333
(17E,20Z,23Z)-10-[2-[ethyl(methyl)amino]ethyl]nonacosa-17,20,23-trienal (PubChem CID 170069333) has the molecular formula C34H63NO and a molecular weight of 501.88 g/mol. Its IUPAC name is (17E,20Z,23Z)-10-[2-[ethyl(methyl)amino]ethyl]nonacosa-17,20,23-trienal.
| Compound Name | (17E,20Z,23Z)-10-[2-[ethyl(methyl)amino]ethyl]nonacosa-17,20,23-trienal |
|---|---|
| PubChem CID | 170069333 |
| Molecular Formula | C34H63NO |
| Molecular Weight | 501.88 g/mol |
| Exact Mass | 501.49 |
| IUPAC Name | (17E,20Z,23Z)-10-[2-[ethyl(methyl)amino]ethyl]nonacosa-17,20,23-trienal |
| SMILES | CCCCC/C=C\C/C=C\C/C=C/CCCCCCC(CCCCCCCCC=O)CCN(C)CC |
| InChI | InChI=1S/C34H63NO/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-20-23-26-29-34(31-32-35(3)5-2)30-27-24-21-19-22-25-28-33-36/h9-10,12-13,15-16,33-34H,4-8,11,14,17-32H2,1-3H3/b10-9-,13-12-,16-15+ |
| InChIKey | MMXTWGCYNAMUNU-GRYCKGJYSA-N |
| XLogP | 10.63 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.88 |
| LogP ≤ 5 | 10.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|