C29H56N2O — CID 170069350
(14E,20Z)-10-[2-[2-(dimethylamino)ethyl-methylamino]ethyl]docosa-14,20-dienal (PubChem CID 170069350) has the molecular formula C29H56N2O and a molecular weight of 448.78 g/mol. Its IUPAC name is (14E,20Z)-10-[2-[2-(dimethylamino)ethyl-methylamino]ethyl]docosa-14,20-dienal.
| Compound Name | (14E,20Z)-10-[2-[2-(dimethylamino)ethyl-methylamino]ethyl]docosa-14,20-dienal |
|---|---|
| PubChem CID | 170069350 |
| Molecular Formula | C29H56N2O |
| Molecular Weight | 448.78 g/mol |
| Exact Mass | 448.44 |
| IUPAC Name | (14E,20Z)-10-[2-[2-(dimethylamino)ethyl-methylamino]ethyl]docosa-14,20-dienal |
| SMILES | C/C=C\CCCC/C=C/CCCC(CCCCCCCCC=O)CCN(C)CCN(C)C |
| InChI | InChI=1S/C29H56N2O/c1-5-6-7-8-9-10-11-13-16-19-22-29(24-25-31(4)27-26-30(2)3)23-20-17-14-12-15-18-21-28-32/h5-6,11,13,28-29H,7-10,12,14-27H2,1-4H3/b6-5-,13-11+ |
| InChIKey | VMNSNHXVNDQKMU-SAJBRBQFSA-N |
| XLogP | 7.67 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.78 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|