C16H21BrN2O4S — CID 170069452
N-[1-[2-(2-bromo-4-methylphenoxy)acetyl]piperidin-4-yl]ethenesulfonamide (PubChem CID 170069452) has the molecular formula C16H21BrN2O4S and a molecular weight of 417.33 g/mol. Its IUPAC name is N-[1-[2-(2-bromo-4-methylphenoxy)acetyl]piperidin-4-yl]ethenesulfonamide.
| Compound Name | N-[1-[2-(2-bromo-4-methylphenoxy)acetyl]piperidin-4-yl]ethenesulfonamide |
|---|---|
| PubChem CID | 170069452 |
| Molecular Formula | C16H21BrN2O4S |
| Molecular Weight | 417.33 g/mol |
| Exact Mass | 416.04 |
| IUPAC Name | N-[1-[2-(2-bromo-4-methylphenoxy)acetyl]piperidin-4-yl]ethenesulfonamide |
| SMILES | C=CS(=O)(=O)NC1CCN(C(=O)COc2ccc(C)cc2Br)CC1 |
| InChI | InChI=1S/C16H21BrN2O4S/c1-3-24(21,22)18-13-6-8-19(9-7-13)16(20)11-23-15-5-4-12(2)10-14(15)17/h3-5,10,13,18H,1,6-9,11H2,2H3 |
| InChIKey | ILFLKHGVNFOWNE-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.33 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |