C39H54FN5O6 — CID 170069700
[(2R,3S)-3-(4-cyclohexylbutanoyloxy)-2-ethynyl-4-[2-fluoro-6-(octanoylamino)purin-9-yl]oxolan-2-yl]methyl bicyclo[2.2.2]octane-1-carboxylate (PubChem CID 170069700) has the molecular formula C39H54FN5O6 and a molecular weight of 707.89 g/mol. Its IUPAC name is [(2R,3S)-3-(4-cyclohexylbutanoyloxy)-2-ethynyl-4-[2-fluoro-6-(octanoylamino)purin-9-yl]oxolan-2-yl]methyl bicyclo[2.2.2]octane-1-carboxylate.
| Compound Name | [(2R,3S)-3-(4-cyclohexylbutanoyloxy)-2-ethynyl-4-[2-fluoro-6-(octanoylamino)purin-9-yl]oxolan-2-yl]methyl bicyclo[2.2.2]octane-1-carboxylate |
|---|---|
| PubChem CID | 170069700 |
| Molecular Formula | C39H54FN5O6 |
| Molecular Weight | 707.89 g/mol |
| Exact Mass | 707.41 |
| IUPAC Name | [(2R,3S)-3-(4-cyclohexylbutanoyloxy)-2-ethynyl-4-[2-fluoro-6-(octanoylamino)purin-9-yl]oxolan-2-yl]methyl bicyclo[2.2.2]octane-1-carboxylate |
| SMILES | C#C[C@]1(COC(=O)C23CCC(CC2)CC3)OCC(n2cnc3c(NC(=O)CCCCCCC)nc(F)nc32)[C@@H]1OC(=O)CCCC1CCCCC1 |
| InChI | InChI=1S/C39H54FN5O6/c1-3-5-6-7-11-16-30(46)42-34-32-35(44-37(40)43-34)45(26-41-32)29-24-50-39(4-2,25-49-36(48)38-21-18-28(19-22-38)20-23-38)33(29)51-31(47)17-12-15-27-13-9-8-10-14-27/h2,26-29,33H,3,5-25H2,1H3,(H,42,43,44,46)/t28?,29?,33-,38?,39+/m0/s1 |
| InChIKey | HCTUDKAZTZNKQK-LHIWXVGRSA-N |
| XLogP | 7.38 |
| TPSA | 134.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.89 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|