C32H21F10N — CID 170069786
(2E)-5-methyl-1-[3-(2,3,4,5,6-pentafluorocyclohexa-2,4-dien-1-yl)-5-(2,3,4,5,6-pentafluorophenyl)phenyl]-2-[(Z)-pent-2-enylidene]-3H-indole (PubChem CID 170069786) has the molecular formula C32H21F10N and a molecular weight of 609.51 g/mol. Its IUPAC name is (2E)-5-methyl-1-[3-(2,3,4,5,6-pentafluorocyclohexa-2,4-dien-1-yl)-5-(2,3,4,5,6-pentafluorophenyl)phenyl]-2-[(Z)-pent-2-enylidene]-3H-indole.
| Compound Name | (2E)-5-methyl-1-[3-(2,3,4,5,6-pentafluorocyclohexa-2,4-dien-1-yl)-5-(2,3,4,5,6-pentafluorophenyl)phenyl]-2-[(Z)-pent-2-enylidene]-3H-indole |
|---|---|
| PubChem CID | 170069786 |
| Molecular Formula | C32H21F10N |
| Molecular Weight | 609.51 g/mol |
| Exact Mass | 609.15 |
| IUPAC Name | (2E)-5-methyl-1-[3-(2,3,4,5,6-pentafluorocyclohexa-2,4-dien-1-yl)-5-(2,3,4,5,6-pentafluorophenyl)phenyl]-2-[(Z)-pent-2-enylidene]-3H-indole |
| SMILES | CC/C=C\C=C1/Cc2cc(C)ccc2N1c1cc(-c2c(F)c(F)c(F)c(F)c2F)cc(C2C(F)=C(F)C(F)=C(F)C2F)c1 |
| InChI | InChI=1S/C32H21F10N/c1-3-4-5-6-18-11-15-9-14(2)7-8-20(15)43(18)19-12-16(21-23(33)27(37)31(41)28(38)24(21)34)10-17(13-19)22-25(35)29(39)32(42)30(40)26(22)36/h4-10,12-13,21,23H,3,11H2,1-2H3/b5-4-,18-6+ |
| InChIKey | FGBNQBONSZZTAS-ZMPDOZHJSA-N |
| XLogP | 10.64 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.51 |
| LogP ≤ 5 | 10.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|