C27H15N3O9 — CID 170070122
2-[(2,5-dioxopyrrol-1-yl)methyl]-5-[2-[(2,5-dioxopyrrol-1-yl)methyl]-1,3-dioxoinden-5-yl]oxyisoindole-1,3-dione (PubChem CID 170070122) has the molecular formula C27H15N3O9 and a molecular weight of 525.43 g/mol. Its IUPAC name is 2-[(2,5-dioxopyrrol-1-yl)methyl]-5-[2-[(2,5-dioxopyrrol-1-yl)methyl]-1,3-dioxoinden-5-yl]oxyisoindole-1,3-dione.
| Compound Name | 2-[(2,5-dioxopyrrol-1-yl)methyl]-5-[2-[(2,5-dioxopyrrol-1-yl)methyl]-1,3-dioxoinden-5-yl]oxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 170070122 |
| Molecular Formula | C27H15N3O9 |
| Molecular Weight | 525.43 g/mol |
| Exact Mass | 525.08 |
| IUPAC Name | 2-[(2,5-dioxopyrrol-1-yl)methyl]-5-[2-[(2,5-dioxopyrrol-1-yl)methyl]-1,3-dioxoinden-5-yl]oxyisoindole-1,3-dione |
| SMILES | O=C1c2ccc(Oc3ccc4c(c3)C(=O)N(CN3C(=O)C=CC3=O)C4=O)cc2C(=O)C1CN1C(=O)C=CC1=O |
| InChI | InChI=1S/C27H15N3O9/c31-20-5-6-21(32)28(20)11-19-24(35)15-3-1-13(9-17(15)25(19)36)39-14-2-4-16-18(10-14)27(38)30(26(16)37)12-29-22(33)7-8-23(29)34/h1-10,19H,11-12H2 |
| InChIKey | ZEZPJWDHVCVUAE-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 155.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.43 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|