About 6-methylspiro[4H-1,4-benzoxazine-2,3'-oxolane]-3-one
6-methylspiro[4H-1,4-benzoxazine-2,3'-oxolane]-3-one (PubChem CID 170070192) has the molecular formula C12H13NO3
and a molecular weight of 219.24 g/mol. Its IUPAC name is 6-methylspiro[4H-1,4-benzoxazine-2,3'-oxolane]-3-one.
Molecular Properties
| Compound Name | 6-methylspiro[4H-1,4-benzoxazine-2,3'-oxolane]-3-one |
| PubChem CID | 170070192 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 6-methylspiro[4H-1,4-benzoxazine-2,3'-oxolane]-3-one |
| SMILES | Cc1ccc2c(c1)NC(=O)C1(CCOC1)O2 |
| InChI | InChI=1S/C12H13NO3/c1-8-2-3-10-9(6-8)13-11(14)12(16-10)4-5-15-7-12/h2-3,6H,4-5,7H2,1H3,(H,13,14) |
| InChIKey | KTKHTJZKVBUCNF-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-methylspiro[4H-1,4-benzoxazine-2,3'-oxolane]-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylspiro[4H-1,4-benzoxazine-2,3'-oxolane]-3-one?
The IUPAC name of 6-methylspiro[4H-1,4-benzoxazine-2,3'-oxolane]-3-one (CID 170070192) is 6-methylspiro[4H-1,4-benzoxazine-2,3'-oxolane]-3-one.
What is the SMILES notation for 6-methylspiro[4H-1,4-benzoxazine-2,3'-oxolane]-3-one?
The canonical SMILES for 6-methylspiro[4H-1,4-benzoxazine-2,3'-oxolane]-3-one is Cc1ccc2c(c1)NC(=O)C1(CCOC1)O2.
What is the InChIKey of 6-methylspiro[4H-1,4-benzoxazine-2,3'-oxolane]-3-one?
The InChIKey is KTKHTJZKVBUCNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO3/c1-8-2-3-10-9(6-8)13-11(14)12(16-10)4-5-15-7-12/h2-3,6H,4-5,7H2,1H3,(H,13,14).
What are the key properties of 6-methylspiro[4H-1,4-benzoxazine-2,3'-oxolane]-3-one?
6-methylspiro[4H-1,4-benzoxazine-2,3'-oxolane]-3-one has a molecular weight of 219.24 g/mol, XLogP of 1.49, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylspiro[4H-1,4-benzoxazine-2,3'-oxolane]-3-one is sourced from PubChem (CID 170070192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).