C18H14ClF2N5O3 — CID 170070299
2-chloroethyl N-[6-(5,8-difluoro-4-hydroxy-3,4-dihydrophthalazin-1-yl)-1H-benzimidazol-2-yl]carbamate (PubChem CID 170070299) has the molecular formula C18H14ClF2N5O3 and a molecular weight of 421.79 g/mol. Its IUPAC name is 2-chloroethyl N-[6-(5,8-difluoro-4-hydroxy-3,4-dihydrophthalazin-1-yl)-1H-benzimidazol-2-yl]carbamate.
| Compound Name | 2-chloroethyl N-[6-(5,8-difluoro-4-hydroxy-3,4-dihydrophthalazin-1-yl)-1H-benzimidazol-2-yl]carbamate |
|---|---|
| PubChem CID | 170070299 |
| Molecular Formula | C18H14ClF2N5O3 |
| Molecular Weight | 421.79 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | 2-chloroethyl N-[6-(5,8-difluoro-4-hydroxy-3,4-dihydrophthalazin-1-yl)-1H-benzimidazol-2-yl]carbamate |
| SMILES | O=C(Nc1nc2ccc(C3=NNC(O)c4c(F)ccc(F)c43)cc2[nH]1)OCCCl |
| InChI | InChI=1S/C18H14ClF2N5O3/c19-5-6-29-18(28)24-17-22-11-4-1-8(7-12(11)23-17)15-13-9(20)2-3-10(21)14(13)16(27)26-25-15/h1-4,7,16,26-27H,5-6H2,(H2,22,23,24,28) |
| InChIKey | AATNVJLSVRBHSS-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.79 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|