About 1-bromo-3-methyl-2-[(1R,3S)-3-methylcyclopentyl]oxybenzene
1-bromo-3-methyl-2-[(1R,3S)-3-methylcyclopentyl]oxybenzene (PubChem CID 170070358) has the molecular formula C13H17BrO
and a molecular weight of 269.18 g/mol. Its IUPAC name is 1-bromo-3-methyl-2-[(1R,3S)-3-methylcyclopentyl]oxybenzene.
Molecular Properties
| Compound Name | 1-bromo-3-methyl-2-[(1R,3S)-3-methylcyclopentyl]oxybenzene |
| PubChem CID | 170070358 |
| Molecular Formula | C13H17BrO |
| Molecular Weight | 269.18 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 1-bromo-3-methyl-2-[(1R,3S)-3-methylcyclopentyl]oxybenzene |
| SMILES | Cc1cccc(Br)c1O[C@@H]1CC[C@H](C)C1 |
| InChI | InChI=1S/C13H17BrO/c1-9-6-7-11(8-9)15-13-10(2)4-3-5-12(13)14/h3-5,9,11H,6-8H2,1-2H3/t9-,11+/m0/s1 |
| InChIKey | NRZAKHXJDHSTMH-GXSJLCMTSA-N |
| XLogP | 4.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.18 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-bromo-3-methyl-2-[(1R,3S)-3-methylcyclopentyl]oxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-3-methyl-2-[(1R,3S)-3-methylcyclopentyl]oxybenzene?
The IUPAC name of 1-bromo-3-methyl-2-[(1R,3S)-3-methylcyclopentyl]oxybenzene (CID 170070358) is 1-bromo-3-methyl-2-[(1R,3S)-3-methylcyclopentyl]oxybenzene.
What is the SMILES notation for 1-bromo-3-methyl-2-[(1R,3S)-3-methylcyclopentyl]oxybenzene?
The canonical SMILES for 1-bromo-3-methyl-2-[(1R,3S)-3-methylcyclopentyl]oxybenzene is Cc1cccc(Br)c1O[C@@H]1CC[C@H](C)C1.
What is the InChIKey of 1-bromo-3-methyl-2-[(1R,3S)-3-methylcyclopentyl]oxybenzene?
The InChIKey is NRZAKHXJDHSTMH-GXSJLCMTSA-N. The full InChI is InChI=1S/C13H17BrO/c1-9-6-7-11(8-9)15-13-10(2)4-3-5-12(13)14/h3-5,9,11H,6-8H2,1-2H3/t9-,11+/m0/s1.
What are the key properties of 1-bromo-3-methyl-2-[(1R,3S)-3-methylcyclopentyl]oxybenzene?
1-bromo-3-methyl-2-[(1R,3S)-3-methylcyclopentyl]oxybenzene has a molecular weight of 269.18 g/mol, XLogP of 4.32, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-3-methyl-2-[(1R,3S)-3-methylcyclopentyl]oxybenzene is sourced from PubChem (CID 170070358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).