About 1-bromo-3-chloro-2-[(1R,3S)-3-methylcyclopentyl]oxybenzene
1-bromo-3-chloro-2-[(1R,3S)-3-methylcyclopentyl]oxybenzene (PubChem CID 170070361) has the molecular formula C12H14BrClO
and a molecular weight of 289.60 g/mol. Its IUPAC name is 1-bromo-3-chloro-2-[(1R,3S)-3-methylcyclopentyl]oxybenzene.
Molecular Properties
| Compound Name | 1-bromo-3-chloro-2-[(1R,3S)-3-methylcyclopentyl]oxybenzene |
| PubChem CID | 170070361 |
| Molecular Formula | C12H14BrClO |
| Molecular Weight | 289.60 g/mol |
| Exact Mass | 287.99 |
| IUPAC Name | 1-bromo-3-chloro-2-[(1R,3S)-3-methylcyclopentyl]oxybenzene |
| SMILES | C[C@H]1CC[C@@H](Oc2c(Cl)cccc2Br)C1 |
| InChI | InChI=1S/C12H14BrClO/c1-8-5-6-9(7-8)15-12-10(13)3-2-4-11(12)14/h2-4,8-9H,5-7H2,1H3/t8-,9+/m0/s1 |
| InChIKey | LBUSYAIAXRUSTQ-DTWKUNHWSA-N |
| XLogP | 4.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.60 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-bromo-3-chloro-2-[(1R,3S)-3-methylcyclopentyl]oxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-3-chloro-2-[(1R,3S)-3-methylcyclopentyl]oxybenzene?
The IUPAC name of 1-bromo-3-chloro-2-[(1R,3S)-3-methylcyclopentyl]oxybenzene (CID 170070361) is 1-bromo-3-chloro-2-[(1R,3S)-3-methylcyclopentyl]oxybenzene.
What is the SMILES notation for 1-bromo-3-chloro-2-[(1R,3S)-3-methylcyclopentyl]oxybenzene?
The canonical SMILES for 1-bromo-3-chloro-2-[(1R,3S)-3-methylcyclopentyl]oxybenzene is C[C@H]1CC[C@@H](Oc2c(Cl)cccc2Br)C1.
What is the InChIKey of 1-bromo-3-chloro-2-[(1R,3S)-3-methylcyclopentyl]oxybenzene?
The InChIKey is LBUSYAIAXRUSTQ-DTWKUNHWSA-N. The full InChI is InChI=1S/C12H14BrClO/c1-8-5-6-9(7-8)15-12-10(13)3-2-4-11(12)14/h2-4,8-9H,5-7H2,1H3/t8-,9+/m0/s1.
What are the key properties of 1-bromo-3-chloro-2-[(1R,3S)-3-methylcyclopentyl]oxybenzene?
1-bromo-3-chloro-2-[(1R,3S)-3-methylcyclopentyl]oxybenzene has a molecular weight of 289.60 g/mol, XLogP of 4.67, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-3-chloro-2-[(1R,3S)-3-methylcyclopentyl]oxybenzene is sourced from PubChem (CID 170070361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).