About 2-bromo-6-iodo-3-[(1R,3S)-3-methylcyclopentyl]oxypyridine
2-bromo-6-iodo-3-[(1R,3S)-3-methylcyclopentyl]oxypyridine (PubChem CID 170070397) has the molecular formula C11H13BrINO
and a molecular weight of 382.04 g/mol. Its IUPAC name is 2-bromo-6-iodo-3-[(1R,3S)-3-methylcyclopentyl]oxypyridine.
Molecular Properties
| Compound Name | 2-bromo-6-iodo-3-[(1R,3S)-3-methylcyclopentyl]oxypyridine |
| PubChem CID | 170070397 |
| Molecular Formula | C11H13BrINO |
| Molecular Weight | 382.04 g/mol |
| Exact Mass | 380.92 |
| IUPAC Name | 2-bromo-6-iodo-3-[(1R,3S)-3-methylcyclopentyl]oxypyridine |
| SMILES | C[C@H]1CC[C@@H](Oc2ccc(I)nc2Br)C1 |
| InChI | InChI=1S/C11H13BrINO/c1-7-2-3-8(6-7)15-9-4-5-10(13)14-11(9)12/h4-5,7-8H,2-3,6H2,1H3/t7-,8+/m0/s1 |
| InChIKey | JUGNBKOFCMPPGQ-JGVFFNPUSA-N |
| XLogP | 4.02 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.04 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-6-iodo-3-[(1R,3S)-3-methylcyclopentyl]oxypyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-6-iodo-3-[(1R,3S)-3-methylcyclopentyl]oxypyridine?
The IUPAC name of 2-bromo-6-iodo-3-[(1R,3S)-3-methylcyclopentyl]oxypyridine (CID 170070397) is 2-bromo-6-iodo-3-[(1R,3S)-3-methylcyclopentyl]oxypyridine.
What is the SMILES notation for 2-bromo-6-iodo-3-[(1R,3S)-3-methylcyclopentyl]oxypyridine?
The canonical SMILES for 2-bromo-6-iodo-3-[(1R,3S)-3-methylcyclopentyl]oxypyridine is C[C@H]1CC[C@@H](Oc2ccc(I)nc2Br)C1.
What is the InChIKey of 2-bromo-6-iodo-3-[(1R,3S)-3-methylcyclopentyl]oxypyridine?
The InChIKey is JUGNBKOFCMPPGQ-JGVFFNPUSA-N. The full InChI is InChI=1S/C11H13BrINO/c1-7-2-3-8(6-7)15-9-4-5-10(13)14-11(9)12/h4-5,7-8H,2-3,6H2,1H3/t7-,8+/m0/s1.
What are the key properties of 2-bromo-6-iodo-3-[(1R,3S)-3-methylcyclopentyl]oxypyridine?
2-bromo-6-iodo-3-[(1R,3S)-3-methylcyclopentyl]oxypyridine has a molecular weight of 382.04 g/mol, XLogP of 4.02, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-6-iodo-3-[(1R,3S)-3-methylcyclopentyl]oxypyridine is sourced from PubChem (CID 170070397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).