About 2-bromo-1-methoxy-3-[(1R,3S)-3-methylcyclopentyl]oxybenzene
2-bromo-1-methoxy-3-[(1R,3S)-3-methylcyclopentyl]oxybenzene (PubChem CID 170070408) has the molecular formula C13H17BrO2
and a molecular weight of 285.18 g/mol. Its IUPAC name is 2-bromo-1-methoxy-3-[(1R,3S)-3-methylcyclopentyl]oxybenzene.
Molecular Properties
| Compound Name | 2-bromo-1-methoxy-3-[(1R,3S)-3-methylcyclopentyl]oxybenzene |
| PubChem CID | 170070408 |
| Molecular Formula | C13H17BrO2 |
| Molecular Weight | 285.18 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 2-bromo-1-methoxy-3-[(1R,3S)-3-methylcyclopentyl]oxybenzene |
| SMILES | COc1cccc(O[C@@H]2CC[C@H](C)C2)c1Br |
| InChI | InChI=1S/C13H17BrO2/c1-9-6-7-10(8-9)16-12-5-3-4-11(15-2)13(12)14/h3-5,9-10H,6-8H2,1-2H3/t9-,10+/m0/s1 |
| InChIKey | CGHRRRRTTHTYGC-VHSXEESVSA-N |
| XLogP | 4.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.18 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-bromo-1-methoxy-3-[(1R,3S)-3-methylcyclopentyl]oxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1-methoxy-3-[(1R,3S)-3-methylcyclopentyl]oxybenzene?
The IUPAC name of 2-bromo-1-methoxy-3-[(1R,3S)-3-methylcyclopentyl]oxybenzene (CID 170070408) is 2-bromo-1-methoxy-3-[(1R,3S)-3-methylcyclopentyl]oxybenzene.
What is the SMILES notation for 2-bromo-1-methoxy-3-[(1R,3S)-3-methylcyclopentyl]oxybenzene?
The canonical SMILES for 2-bromo-1-methoxy-3-[(1R,3S)-3-methylcyclopentyl]oxybenzene is COc1cccc(O[C@@H]2CC[C@H](C)C2)c1Br.
What is the InChIKey of 2-bromo-1-methoxy-3-[(1R,3S)-3-methylcyclopentyl]oxybenzene?
The InChIKey is CGHRRRRTTHTYGC-VHSXEESVSA-N. The full InChI is InChI=1S/C13H17BrO2/c1-9-6-7-10(8-9)16-12-5-3-4-11(15-2)13(12)14/h3-5,9-10H,6-8H2,1-2H3/t9-,10+/m0/s1.
What are the key properties of 2-bromo-1-methoxy-3-[(1R,3S)-3-methylcyclopentyl]oxybenzene?
2-bromo-1-methoxy-3-[(1R,3S)-3-methylcyclopentyl]oxybenzene has a molecular weight of 285.18 g/mol, XLogP of 4.03, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1-methoxy-3-[(1R,3S)-3-methylcyclopentyl]oxybenzene is sourced from PubChem (CID 170070408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).