About 1-[(2,4-difluorocyclohexa-1,3-dien-1-yl)methyl]piperazine
1-[(2,4-difluorocyclohexa-1,3-dien-1-yl)methyl]piperazine (PubChem CID 170070494) has the molecular formula C11H16F2N2
and a molecular weight of 214.26 g/mol. Its IUPAC name is 1-[(2,4-difluorocyclohexa-1,3-dien-1-yl)methyl]piperazine.
Molecular Properties
| Compound Name | 1-[(2,4-difluorocyclohexa-1,3-dien-1-yl)methyl]piperazine |
| PubChem CID | 170070494 |
| Molecular Formula | C11H16F2N2 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | 1-[(2,4-difluorocyclohexa-1,3-dien-1-yl)methyl]piperazine |
| SMILES | FC1=CC(F)=C(CN2CCNCC2)CC1 |
| InChI | InChI=1S/C11H16F2N2/c12-10-2-1-9(11(13)7-10)8-15-5-3-14-4-6-15/h7,14H,1-6,8H2 |
| InChIKey | ORKUZHUGGLTNHD-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(2,4-difluorocyclohexa-1,3-dien-1-yl)methyl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2,4-difluorocyclohexa-1,3-dien-1-yl)methyl]piperazine?
The IUPAC name of 1-[(2,4-difluorocyclohexa-1,3-dien-1-yl)methyl]piperazine (CID 170070494) is 1-[(2,4-difluorocyclohexa-1,3-dien-1-yl)methyl]piperazine.
What is the SMILES notation for 1-[(2,4-difluorocyclohexa-1,3-dien-1-yl)methyl]piperazine?
The canonical SMILES for 1-[(2,4-difluorocyclohexa-1,3-dien-1-yl)methyl]piperazine is FC1=CC(F)=C(CN2CCNCC2)CC1.
What is the InChIKey of 1-[(2,4-difluorocyclohexa-1,3-dien-1-yl)methyl]piperazine?
The InChIKey is ORKUZHUGGLTNHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16F2N2/c12-10-2-1-9(11(13)7-10)8-15-5-3-14-4-6-15/h7,14H,1-6,8H2.
What are the key properties of 1-[(2,4-difluorocyclohexa-1,3-dien-1-yl)methyl]piperazine?
1-[(2,4-difluorocyclohexa-1,3-dien-1-yl)methyl]piperazine has a molecular weight of 214.26 g/mol, XLogP of 1.76, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,4-difluorocyclohexa-1,3-dien-1-yl)methyl]piperazine is sourced from PubChem (CID 170070494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).