C14H23NO — CID 170070651
(1S,5aS)-1-amino-5a-methyl-9-methylidene-3,4,5,6,7,8-hexahydro-2H-heptalen-1-ol (PubChem CID 170070651) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is (1S,5aS)-1-amino-5a-methyl-9-methylidene-3,4,5,6,7,8-hexahydro-2H-heptalen-1-ol.
| Compound Name | (1S,5aS)-1-amino-5a-methyl-9-methylidene-3,4,5,6,7,8-hexahydro-2H-heptalen-1-ol |
|---|---|
| PubChem CID | 170070651 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | (1S,5aS)-1-amino-5a-methyl-9-methylidene-3,4,5,6,7,8-hexahydro-2H-heptalen-1-ol |
| SMILES | C=C1C=C2[C@@](C)(CCCC[C@]2(N)O)CCC1 |
| InChI | InChI=1S/C14H23NO/c1-11-6-5-8-13(2)7-3-4-9-14(15,16)12(13)10-11/h10,16H,1,3-9,15H2,2H3/t13-,14-/m0/s1 |
| InChIKey | FGNWIILTCNEGOM-KBPBESRZSA-N |
| XLogP | 2.88 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|