C16H20N6O — CID 170070893
3-amino-1-[[2-methyl-6-(2-methylpropyl)-7H-purin-8-yl]methyl]pyridin-2-one (PubChem CID 170070893) has the molecular formula C16H20N6O and a molecular weight of 312.38 g/mol. Its IUPAC name is 3-amino-1-[[2-methyl-6-(2-methylpropyl)-7H-purin-8-yl]methyl]pyridin-2-one.
| Compound Name | 3-amino-1-[[2-methyl-6-(2-methylpropyl)-7H-purin-8-yl]methyl]pyridin-2-one |
|---|---|
| PubChem CID | 170070893 |
| Molecular Formula | C16H20N6O |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 3-amino-1-[[2-methyl-6-(2-methylpropyl)-7H-purin-8-yl]methyl]pyridin-2-one |
| SMILES | Cc1nc(CC(C)C)c2[nH]c(Cn3cccc(N)c3=O)nc2n1 |
| InChI | InChI=1S/C16H20N6O/c1-9(2)7-12-14-15(19-10(3)18-12)21-13(20-14)8-22-6-4-5-11(17)16(22)23/h4-6,9H,7-8,17H2,1-3H3,(H,18,19,20,21) |
| InChIKey | RCCNZBANSPSTSF-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |