About N'-(3,3-dimethylbutyl)-N-methyl-N'-(3-methylbut-1-en-2-yl)methanediamine
N'-(3,3-dimethylbutyl)-N-methyl-N'-(3-methylbut-1-en-2-yl)methanediamine (PubChem CID 170071579) has the molecular formula C13H28N2
and a molecular weight of 212.38 g/mol. Its IUPAC name is N'-(3,3-dimethylbutyl)-N-methyl-N'-(3-methylbut-1-en-2-yl)methanediamine.
Molecular Properties
| Compound Name | N'-(3,3-dimethylbutyl)-N-methyl-N'-(3-methylbut-1-en-2-yl)methanediamine |
| PubChem CID | 170071579 |
| Molecular Formula | C13H28N2 |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.23 |
| IUPAC Name | N'-(3,3-dimethylbutyl)-N-methyl-N'-(3-methylbut-1-en-2-yl)methanediamine |
| SMILES | C=C(C(C)C)N(CCC(C)(C)C)CNC |
| InChI | InChI=1S/C13H28N2/c1-11(2)12(3)15(10-14-7)9-8-13(4,5)6/h11,14H,3,8-10H2,1-2,4-7H3 |
| InChIKey | YEBANQQGGMJJNH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N'-(3,3-dimethylbutyl)-N-methyl-N'-(3-methylbut-1-en-2-yl)methanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(3,3-dimethylbutyl)-N-methyl-N'-(3-methylbut-1-en-2-yl)methanediamine?
The IUPAC name of N'-(3,3-dimethylbutyl)-N-methyl-N'-(3-methylbut-1-en-2-yl)methanediamine (CID 170071579) is N'-(3,3-dimethylbutyl)-N-methyl-N'-(3-methylbut-1-en-2-yl)methanediamine.
What is the SMILES notation for N'-(3,3-dimethylbutyl)-N-methyl-N'-(3-methylbut-1-en-2-yl)methanediamine?
The canonical SMILES for N'-(3,3-dimethylbutyl)-N-methyl-N'-(3-methylbut-1-en-2-yl)methanediamine is C=C(C(C)C)N(CCC(C)(C)C)CNC.
What is the InChIKey of N'-(3,3-dimethylbutyl)-N-methyl-N'-(3-methylbut-1-en-2-yl)methanediamine?
The InChIKey is YEBANQQGGMJJNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28N2/c1-11(2)12(3)15(10-14-7)9-8-13(4,5)6/h11,14H,3,8-10H2,1-2,4-7H3.
What are the key properties of N'-(3,3-dimethylbutyl)-N-methyl-N'-(3-methylbut-1-en-2-yl)methanediamine?
N'-(3,3-dimethylbutyl)-N-methyl-N'-(3-methylbut-1-en-2-yl)methanediamine has a molecular weight of 212.38 g/mol, XLogP of 3.07, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(3,3-dimethylbutyl)-N-methyl-N'-(3-methylbut-1-en-2-yl)methanediamine is sourced from PubChem (CID 170071579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).