C18H24N4O9 — CID 170072171
4-[[(3S)-4-(3-carboxypropylamino)-3-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-4-oxobutanoyl]amino]butanoic acid (PubChem CID 170072171) has the molecular formula C18H24N4O9 and a molecular weight of 440.41 g/mol. Its IUPAC name is 4-[[(3S)-4-(3-carboxypropylamino)-3-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-4-oxobutanoyl]amino]butanoic acid.
| Compound Name | 4-[[(3S)-4-(3-carboxypropylamino)-3-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-4-oxobutanoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 170072171 |
| Molecular Formula | C18H24N4O9 |
| Molecular Weight | 440.41 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | 4-[[(3S)-4-(3-carboxypropylamino)-3-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-4-oxobutanoyl]amino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)C[C@H](NC(=O)CN1C(=O)C=CC1=O)C(=O)NCCCC(=O)O |
| InChI | InChI=1S/C18H24N4O9/c23-12(19-7-1-3-16(27)28)9-11(18(31)20-8-2-4-17(29)30)21-13(24)10-22-14(25)5-6-15(22)26/h5-6,11H,1-4,7-10H2,(H,19,23)(H,20,31)(H,21,24)(H,27,28)(H,29,30)/t11-/m0/s1 |
| InChIKey | NSVQBUFKTNZIDD-NSHDSACASA-N |
| XLogP | -2.25 |
| TPSA | 199.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.41 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|