C21H27F3N4 — CID 170073122
(2E,4Z,6Z,8Z)-8-N-ethyl-9-(methylideneamino)-4-prop-2-enylidene-1-N-[(Z)-3,3,3-trifluoro-1-(methylideneamino)prop-1-en-2-yl]undeca-2,6,8,10-tetraene-1,8-diamine (PubChem CID 170073122) has the molecular formula C21H27F3N4 and a molecular weight of 392.47 g/mol. Its IUPAC name is (2E,4Z,6Z,8Z)-8-N-ethyl-9-(methylideneamino)-4-prop-2-enylidene-1-N-[(Z)-3,3,3-trifluoro-1-(methylideneamino)prop-1-en-2-yl]undeca-2,6,8,10-tetraene-1,8-diamine.
| Compound Name | (2E,4Z,6Z,8Z)-8-N-ethyl-9-(methylideneamino)-4-prop-2-enylidene-1-N-[(Z)-3,3,3-trifluoro-1-(methylideneamino)prop-1-en-2-yl]undeca-2,6,8,10-tetraene-1,8-diamine |
|---|---|
| PubChem CID | 170073122 |
| Molecular Formula | C21H27F3N4 |
| Molecular Weight | 392.47 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | (2E,4Z,6Z,8Z)-8-N-ethyl-9-(methylideneamino)-4-prop-2-enylidene-1-N-[(Z)-3,3,3-trifluoro-1-(methylideneamino)prop-1-en-2-yl]undeca-2,6,8,10-tetraene-1,8-diamine |
| SMILES | C=C/C=C(\C=C\CN/C(=C\N=C)C(F)(F)F)C/C=C\C(NCC)=C(/C=C)N=C |
| InChI | InChI=1S/C21H27F3N4/c1-6-11-17(12-9-14-19(27-8-3)18(7-2)26-5)13-10-15-28-20(16-25-4)21(22,23)24/h6-7,9-11,13-14,16,27-28H,1-2,4-5,8,12,15H2,3H3/b13-10+,14-9-,17-11-,19-18-,20-16- |
| InChIKey | VBIXFRNJAGOQAT-NTASJNRRSA-N |
| XLogP | 5.00 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.47 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|