About N-methyl-4-[(3-methylimidazolidin-1-yl)methyl]-3-(trifluoromethyl)cyclohexa-1,3-dien-1-amine
N-methyl-4-[(3-methylimidazolidin-1-yl)methyl]-3-(trifluoromethyl)cyclohexa-1,3-dien-1-amine (PubChem CID 170073235) has the molecular formula C13H20F3N3
and a molecular weight of 275.32 g/mol. Its IUPAC name is N-methyl-4-[(3-methylimidazolidin-1-yl)methyl]-3-(trifluoromethyl)cyclohexa-1,3-dien-1-amine.
Molecular Properties
| Compound Name | N-methyl-4-[(3-methylimidazolidin-1-yl)methyl]-3-(trifluoromethyl)cyclohexa-1,3-dien-1-amine |
| PubChem CID | 170073235 |
| Molecular Formula | C13H20F3N3 |
| Molecular Weight | 275.32 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | N-methyl-4-[(3-methylimidazolidin-1-yl)methyl]-3-(trifluoromethyl)cyclohexa-1,3-dien-1-amine |
| SMILES | CNC1=CC(C(F)(F)F)=C(CN2CCN(C)C2)CC1 |
| InChI | InChI=1S/C13H20F3N3/c1-17-11-4-3-10(12(7-11)13(14,15)16)8-19-6-5-18(2)9-19/h7,17H,3-6,8-9H2,1-2H3 |
| InChIKey | RKXCLEGCUHGBJY-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.32 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-methyl-4-[(3-methylimidazolidin-1-yl)methyl]-3-(trifluoromethyl)cyclohexa-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-4-[(3-methylimidazolidin-1-yl)methyl]-3-(trifluoromethyl)cyclohexa-1,3-dien-1-amine?
The IUPAC name of N-methyl-4-[(3-methylimidazolidin-1-yl)methyl]-3-(trifluoromethyl)cyclohexa-1,3-dien-1-amine (CID 170073235) is N-methyl-4-[(3-methylimidazolidin-1-yl)methyl]-3-(trifluoromethyl)cyclohexa-1,3-dien-1-amine.
What is the SMILES notation for N-methyl-4-[(3-methylimidazolidin-1-yl)methyl]-3-(trifluoromethyl)cyclohexa-1,3-dien-1-amine?
The canonical SMILES for N-methyl-4-[(3-methylimidazolidin-1-yl)methyl]-3-(trifluoromethyl)cyclohexa-1,3-dien-1-amine is CNC1=CC(C(F)(F)F)=C(CN2CCN(C)C2)CC1.
What is the InChIKey of N-methyl-4-[(3-methylimidazolidin-1-yl)methyl]-3-(trifluoromethyl)cyclohexa-1,3-dien-1-amine?
The InChIKey is RKXCLEGCUHGBJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20F3N3/c1-17-11-4-3-10(12(7-11)13(14,15)16)8-19-6-5-18(2)9-19/h7,17H,3-6,8-9H2,1-2H3.
What are the key properties of N-methyl-4-[(3-methylimidazolidin-1-yl)methyl]-3-(trifluoromethyl)cyclohexa-1,3-dien-1-amine?
N-methyl-4-[(3-methylimidazolidin-1-yl)methyl]-3-(trifluoromethyl)cyclohexa-1,3-dien-1-amine has a molecular weight of 275.32 g/mol, XLogP of 1.95, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-4-[(3-methylimidazolidin-1-yl)methyl]-3-(trifluoromethyl)cyclohexa-1,3-dien-1-amine is sourced from PubChem (CID 170073235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).