C24H30N2 — CID 170073666
N-[(2Z,4E,5Z)-4-ethylideneocta-2,5,7-trien-3-yl]-6-methylidene-3-(1-piperidin-1-ylethenyl)cyclohexa-2,4-dien-1-imine (PubChem CID 170073666) has the molecular formula C24H30N2 and a molecular weight of 346.52 g/mol. Its IUPAC name is N-[(2Z,4E,5Z)-4-ethylideneocta-2,5,7-trien-3-yl]-6-methylidene-3-(1-piperidin-1-ylethenyl)cyclohexa-2,4-dien-1-imine.
| Compound Name | N-[(2Z,4E,5Z)-4-ethylideneocta-2,5,7-trien-3-yl]-6-methylidene-3-(1-piperidin-1-ylethenyl)cyclohexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 170073666 |
| Molecular Formula | C24H30N2 |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | N-[(2Z,4E,5Z)-4-ethylideneocta-2,5,7-trien-3-yl]-6-methylidene-3-(1-piperidin-1-ylethenyl)cyclohexa-2,4-dien-1-imine |
| SMILES | C=C/C=C\C(=C/C)C(=C\C)\N=C1/C=C(C(=C)N2CCCCC2)C=CC1=C |
| InChI | InChI=1S/C24H30N2/c1-6-9-13-21(7-2)23(8-3)25-24-18-22(15-14-19(24)4)20(5)26-16-11-10-12-17-26/h6-9,13-15,18H,1,4-5,10-12,16-17H2,2-3H3/b13-9-,21-7+,23-8-,25-24+ |
| InChIKey | MQRSCNYDYZHZJS-LFSLRRBGSA-N |
| XLogP | 6.07 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|