About 2-[(E)-5-cyclopropylpent-3-enyl]sulfanyl-4,5-bis(4-methoxyphenyl)-1,3-oxazole
2-[(E)-5-cyclopropylpent-3-enyl]sulfanyl-4,5-bis(4-methoxyphenyl)-1,3-oxazole (PubChem CID 170073742) has the molecular formula C25H27NO3S
and a molecular weight of 421.56 g/mol. Its IUPAC name is 2-[(E)-5-cyclopropylpent-3-enyl]sulfanyl-4,5-bis(4-methoxyphenyl)-1,3-oxazole.
Molecular Properties
| Compound Name | 2-[(E)-5-cyclopropylpent-3-enyl]sulfanyl-4,5-bis(4-methoxyphenyl)-1,3-oxazole |
| PubChem CID | 170073742 |
| Molecular Formula | C25H27NO3S |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | 2-[(E)-5-cyclopropylpent-3-enyl]sulfanyl-4,5-bis(4-methoxyphenyl)-1,3-oxazole |
| SMILES | COc1ccc(-c2nc(SCC/C=C/CC3CC3)oc2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C25H27NO3S/c1-27-21-13-9-19(10-14-21)23-24(20-11-15-22(28-2)16-12-20)29-25(26-23)30-17-5-3-4-6-18-7-8-18/h3-4,9-16,18H,5-8,17H2,1-2H3/b4-3+ |
| InChIKey | AWVZZTKIKXIPLA-ONEGZZNKSA-N |
| XLogP | 6.86 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-5-cyclopropylpent-3-enyl]sulfanyl-4,5-bis(4-methoxyphenyl)-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-5-cyclopropylpent-3-enyl]sulfanyl-4,5-bis(4-methoxyphenyl)-1,3-oxazole?
The IUPAC name of 2-[(E)-5-cyclopropylpent-3-enyl]sulfanyl-4,5-bis(4-methoxyphenyl)-1,3-oxazole (CID 170073742) is 2-[(E)-5-cyclopropylpent-3-enyl]sulfanyl-4,5-bis(4-methoxyphenyl)-1,3-oxazole.
What is the SMILES notation for 2-[(E)-5-cyclopropylpent-3-enyl]sulfanyl-4,5-bis(4-methoxyphenyl)-1,3-oxazole?
The canonical SMILES for 2-[(E)-5-cyclopropylpent-3-enyl]sulfanyl-4,5-bis(4-methoxyphenyl)-1,3-oxazole is COc1ccc(-c2nc(SCC/C=C/CC3CC3)oc2-c2ccc(OC)cc2)cc1.
What is the InChIKey of 2-[(E)-5-cyclopropylpent-3-enyl]sulfanyl-4,5-bis(4-methoxyphenyl)-1,3-oxazole?
The InChIKey is AWVZZTKIKXIPLA-ONEGZZNKSA-N. The full InChI is InChI=1S/C25H27NO3S/c1-27-21-13-9-19(10-14-21)23-24(20-11-15-22(28-2)16-12-20)29-25(26-23)30-17-5-3-4-6-18-7-8-18/h3-4,9-16,18H,5-8,17H2,1-2H3/b4-3+.
What are the key properties of 2-[(E)-5-cyclopropylpent-3-enyl]sulfanyl-4,5-bis(4-methoxyphenyl)-1,3-oxazole?
2-[(E)-5-cyclopropylpent-3-enyl]sulfanyl-4,5-bis(4-methoxyphenyl)-1,3-oxazole has a molecular weight of 421.56 g/mol, XLogP of 6.86, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-5-cyclopropylpent-3-enyl]sulfanyl-4,5-bis(4-methoxyphenyl)-1,3-oxazole is sourced from PubChem (CID 170073742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).