C25H32N8O — CID 170073747
1-[2-(2,3,3a,5,6,6a-hexahydro-1H-pyrrolo[3,2-b]pyrrol-4-yl)-6-[6-[[(1E,3Z)-1,4-diaminopenta-1,3-dienyl]amino]benzimidazol-1-yl]-3-pyridinyl]ethanol (PubChem CID 170073747) has the molecular formula C25H32N8O and a molecular weight of 460.59 g/mol. Its IUPAC name is 1-[2-(2,3,3a,5,6,6a-hexahydro-1H-pyrrolo[3,2-b]pyrrol-4-yl)-6-[6-[[(1E,3Z)-1,4-diaminopenta-1,3-dienyl]amino]benzimidazol-1-yl]-3-pyridinyl]ethanol.
| Compound Name | 1-[2-(2,3,3a,5,6,6a-hexahydro-1H-pyrrolo[3,2-b]pyrrol-4-yl)-6-[6-[[(1E,3Z)-1,4-diaminopenta-1,3-dienyl]amino]benzimidazol-1-yl]-3-pyridinyl]ethanol |
|---|---|
| PubChem CID | 170073747 |
| Molecular Formula | C25H32N8O |
| Molecular Weight | 460.59 g/mol |
| Exact Mass | 460.27 |
| IUPAC Name | 1-[2-(2,3,3a,5,6,6a-hexahydro-1H-pyrrolo[3,2-b]pyrrol-4-yl)-6-[6-[[(1E,3Z)-1,4-diaminopenta-1,3-dienyl]amino]benzimidazol-1-yl]-3-pyridinyl]ethanol |
| SMILES | C/C(N)=C/C=C(\N)Nc1ccc2ncn(-c3ccc(C(C)O)c(N4CCC5NCCC54)n3)c2c1 |
| InChI | InChI=1S/C25H32N8O/c1-15(26)3-7-23(27)30-17-4-6-19-22(13-17)33(14-29-19)24-8-5-18(16(2)34)25(31-24)32-12-10-20-21(32)9-11-28-20/h3-8,13-14,16,20-21,28,30,34H,9-12,26-27H2,1-2H3/b15-3-,23-7+ |
| InChIKey | HRCAWQXYTMMLJR-VAGMSUGYSA-N |
| XLogP | 2.49 |
| TPSA | 130.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.59 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|